![[ICO]](/icons/blank.gif){kind=icon}
![[DIR]](/icons/back.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| README.html | 29-Dec-2007 11:17 | 292 | |
| abdera/ | 11-Apr-2008 11:48 | - | |
| buildr/ | 24-Jul-2008 14:39 | - | |
| couchdb/ | 16-Aug-2008 10:11 | - | |
| cxf/ | 10-Apr-2008 17:32 | - | |
| nmaven/ | 30-Mar-2008 06:00 | - | |
| pig/ | 14-Jul-2008 18:29 | - | |
| qpid/ | 14-May-2008 14:09 | - | |
| river/ | 15-Feb-2008 09:28 | - | |
| sanselan/ | 30-Jul-2008 04:22 | - | |
| sling/ | 23-Jun-2008 05:45 | - | |
| tika/ | 07-Jan-2008 09:57 | - | |
| tuscany/ | 04-Feb-2008 09:56 | - | |
| uima/ | 12-Aug-2008 04:44 | - | |
The Incubator is currently under the process of transferring releases into this structure. Please do not just dive in and create a release structure without asking on the general list first.